C12H12N2O3S — CID 137165796
(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-2-ethylimino-1,3-thiazolidin-4-one (PubChem CID 137165796) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is (5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-2-ethylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-2-ethylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137165796 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-2-ethylimino-1,3-thiazolidin-4-one |
| SMILES | CC/N=C1\NC(=O)/C(=C/c2ccc(O)cc2O)S1 |
| InChI | InChI=1S/C12H12N2O3S/c1-2-13-12-14-11(17)10(18-12)5-7-3-4-8(15)6-9(7)16/h3-6,15-16H,2H2,1H3,(H,13,14,17)/b10-5- |
| InChIKey | LSRDEVSZBOLZMC-YHYXMXQVSA-N |
| XLogP | 1.68 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|