C8H11N5 — CID 136847526
[5-(2-methylpyrazol-3-yl)-1H-imidazol-2-yl]methanamine (PubChem CID 136847526) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is [5-(2-methylpyrazol-3-yl)-1H-imidazol-2-yl]methanamine.
| Compound Name | [5-(2-methylpyrazol-3-yl)-1H-imidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 136847526 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | [5-(2-methylpyrazol-3-yl)-1H-imidazol-2-yl]methanamine |
| SMILES | Cn1nccc1-c1cnc(CN)[nH]1 |
| InChI | InChI=1S/C8H11N5/c1-13-7(2-3-11-13)6-5-10-8(4-9)12-6/h2-3,5H,4,9H2,1H3,(H,10,12) |
| InChIKey | SMRRKSRAKKAYCE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |