C22H18F3N5O2 — CID 136852952
(5R,7S)-N-(4-cyanophenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136852952) has the molecular formula C22H18F3N5O2 and a molecular weight of 441.41 g/mol. Its IUPAC name is (5R,7S)-N-(4-cyanophenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7S)-N-(4-cyanophenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136852952 |
| Molecular Formula | C22H18F3N5O2 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (5R,7S)-N-(4-cyanophenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)Nc4ccc(C#N)cc4)cc3N2)cc1 |
| InChI | InChI=1S/C22H18F3N5O2/c1-32-16-8-4-14(5-9-16)17-10-19(22(23,24)25)30-20(28-17)11-18(29-30)21(31)27-15-6-2-13(12-26)3-7-15/h2-9,11,17,19,28H,10H2,1H3,(H,27,31)/t17-,19+/m1/s1 |
| InChIKey | WWECYCCQMOLQFC-MJGOQNOKSA-N |
| XLogP | 4.68 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |