C9H7N3O2 — CID 136857277
(2E,3E)-2,3-bis(hydroxyimino)-3-phenylpropanenitrile (PubChem CID 136857277) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is (2E,3E)-2,3-bis(hydroxyimino)-3-phenylpropanenitrile.
| Compound Name | (2E,3E)-2,3-bis(hydroxyimino)-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 136857277 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (2E,3E)-2,3-bis(hydroxyimino)-3-phenylpropanenitrile |
| SMILES | N#CC(=N/O)/C(=N/O)c1ccccc1 |
| InChI | InChI=1S/C9H7N3O2/c10-6-8(11-13)9(12-14)7-4-2-1-3-5-7/h1-5,13-14H/b11-8-,12-9+ |
| InChIKey | OMQXRBPFXVXZMI-QABOREQESA-N |
| XLogP | 1.22 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|