C10H15Cl2N3O — CID 136857324
5-chloro-4-[(4-chloro-2,2-dimethylbutyl)amino]-1H-pyrimidin-6-one (PubChem CID 136857324) has the molecular formula C10H15Cl2N3O and a molecular weight of 264.16 g/mol. Its IUPAC name is 5-chloro-4-[(4-chloro-2,2-dimethylbutyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[(4-chloro-2,2-dimethylbutyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136857324 |
| Molecular Formula | C10H15Cl2N3O |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-chloro-4-[(4-chloro-2,2-dimethylbutyl)amino]-1H-pyrimidin-6-one |
| SMILES | CC(C)(CCCl)CNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C10H15Cl2N3O/c1-10(2,3-4-11)5-13-8-7(12)9(16)15-6-14-8/h6H,3-5H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | YDKJOWKYIRNRCK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|