C11H11N3O3 — CID 136863241
4-[(2-methoxyphenyl)diazenyl]-3-methyl-2H-1,2-oxazol-5-one (PubChem CID 136863241) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)diazenyl]-3-methyl-2H-1,2-oxazol-5-one.
| Compound Name | 4-[(2-methoxyphenyl)diazenyl]-3-methyl-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 136863241 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-[(2-methoxyphenyl)diazenyl]-3-methyl-2H-1,2-oxazol-5-one |
| SMILES | COc1ccccc1/N=N/c1c(C)[nH]oc1=O |
| InChI | InChI=1S/C11H11N3O3/c1-7-10(11(15)17-14-7)13-12-8-5-3-4-6-9(8)16-2/h3-6,14H,1-2H3/b13-12+ |
| InChIKey | WDWKKELKGCQLTQ-OUKQBFOZSA-N |
| XLogP | 2.70 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|