C16H18N2OS — CID 21342477
(3,5-dimethyl-2-methylsulfanylphenyl)-(2-methoxyphenyl)diazene (PubChem CID 21342477) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is (3,5-dimethyl-2-methylsulfanylphenyl)-(2-methoxyphenyl)diazene.
| Compound Name | (3,5-dimethyl-2-methylsulfanylphenyl)-(2-methoxyphenyl)diazene |
|---|---|
| PubChem CID | 21342477 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (3,5-dimethyl-2-methylsulfanylphenyl)-(2-methoxyphenyl)diazene |
| SMILES | COc1ccccc1/N=N/c1cc(C)cc(C)c1SC |
| InChI | InChI=1S/C16H18N2OS/c1-11-9-12(2)16(20-4)14(10-11)18-17-13-7-5-6-8-15(13)19-3/h5-10H,1-4H3/b18-17+ |
| InChIKey | QKAAFJMLUVRAGD-ISLYRVAYSA-N |
| XLogP | 5.45 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|