C12H18N2O — CID 21343007
(2-methoxy-3,5-dimethylphenyl)-propan-2-yldiazene (PubChem CID 21343007) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (2-methoxy-3,5-dimethylphenyl)-propan-2-yldiazene.
| Compound Name | (2-methoxy-3,5-dimethylphenyl)-propan-2-yldiazene |
|---|---|
| PubChem CID | 21343007 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (2-methoxy-3,5-dimethylphenyl)-propan-2-yldiazene |
| SMILES | COc1c(C)cc(C)cc1/N=N/C(C)C |
| InChI | InChI=1S/C12H18N2O/c1-8(2)13-14-11-7-9(3)6-10(4)12(11)15-5/h6-8H,1-5H3/b14-13+ |
| InChIKey | HQPJNMLKHQPNKK-BUHFOSPRSA-N |
| XLogP | 3.80 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|