C15H16N2O3S — CID 21343022
N-(2-methoxy-3,5-dimethylphenyl)iminobenzenesulfonamide (PubChem CID 21343022) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(2-methoxy-3,5-dimethylphenyl)iminobenzenesulfonamide.
| Compound Name | N-(2-methoxy-3,5-dimethylphenyl)iminobenzenesulfonamide |
|---|---|
| PubChem CID | 21343022 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(2-methoxy-3,5-dimethylphenyl)iminobenzenesulfonamide |
| SMILES | COc1c(C)cc(C)cc1/N=N/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O3S/c1-11-9-12(2)15(20-3)14(10-11)16-17-21(18,19)13-7-5-4-6-8-13/h4-10H,1-3H3/b17-16+ |
| InChIKey | YOINTWUNICIASC-WUKNDPDISA-N |
| XLogP | 3.78 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|