C17H22N2OSi — CID 21343001
[dimethyl(phenyl)silyl]-(2-methoxy-3,5-dimethylphenyl)diazene (PubChem CID 21343001) has the molecular formula C17H22N2OSi and a molecular weight of 298.46 g/mol. Its IUPAC name is [dimethyl(phenyl)silyl]-(2-methoxy-3,5-dimethylphenyl)diazene.
| Compound Name | [dimethyl(phenyl)silyl]-(2-methoxy-3,5-dimethylphenyl)diazene |
|---|---|
| PubChem CID | 21343001 |
| Molecular Formula | C17H22N2OSi |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | [dimethyl(phenyl)silyl]-(2-methoxy-3,5-dimethylphenyl)diazene |
| SMILES | COc1c(C)cc(C)cc1/N=N/[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H22N2OSi/c1-13-11-14(2)17(20-3)16(12-13)18-19-21(4,5)15-9-7-6-8-10-15/h6-12H,1-5H3/b19-18+ |
| InChIKey | BAPMKKCWLRKECS-VHEBQXMUSA-N |
| XLogP | 4.51 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|