C26H23N5O — CID 136866247
4-(1H-benzimidazol-2-yl)-2-[[bis(pyridin-2-ylmethyl)amino]methyl]phenol (PubChem CID 136866247) has the molecular formula C26H23N5O and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-2-[[bis(pyridin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 4-(1H-benzimidazol-2-yl)-2-[[bis(pyridin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 136866247 |
| Molecular Formula | C26H23N5O |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-2-[[bis(pyridin-2-ylmethyl)amino]methyl]phenol |
| SMILES | Oc1ccc(-c2nc3ccccc3[nH]2)cc1CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C26H23N5O/c32-25-12-11-19(26-29-23-9-1-2-10-24(23)30-26)15-20(25)16-31(17-21-7-3-5-13-27-21)18-22-8-4-6-14-28-22/h1-15,32H,16-18H2,(H,29,30) |
| InChIKey | BFOUTFYPUKPRRB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|