C22H28N4O3 — CID 136866474
5-[2-[(3S,3aR,4S,8aR)-4-hydroxy-3-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[2,3-c]azepin-1-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one (PubChem CID 136866474) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 5-[2-[(3S,3aR,4S,8aR)-4-hydroxy-3-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[2,3-c]azepin-1-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 5-[2-[(3S,3aR,4S,8aR)-4-hydroxy-3-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[2,3-c]azepin-1-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136866474 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 5-[2-[(3S,3aR,4S,8aR)-4-hydroxy-3-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[2,3-c]azepin-1-yl]-2-oxoethyl]-2,4-dimethyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C)c(CC(=O)N2C[C@H](c3ccccc3)[C@H]3[C@@H](O)CCNC[C@@H]32)c(=O)[nH]1 |
| InChI | InChI=1S/C22H28N4O3/c1-13-16(22(29)25-14(2)24-13)10-20(28)26-12-17(15-6-4-3-5-7-15)21-18(26)11-23-9-8-19(21)27/h3-7,17-19,21,23,27H,8-12H2,1-2H3,(H,24,25,29)/t17-,18+,19+,21-/m1/s1 |
| InChIKey | NZJIUTMYMZKJKN-XODKDNOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |