C13H21N5O3 — CID 136868891
2-[[2-[(Z)-N'-hydroxycarbamimidoyl]-4-pyridinyl]methylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 136868891) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[[2-[(Z)-N'-hydroxycarbamimidoyl]-4-pyridinyl]methylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[[2-[(Z)-N'-hydroxycarbamimidoyl]-4-pyridinyl]methylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 136868891 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-[[2-[(Z)-N'-hydroxycarbamimidoyl]-4-pyridinyl]methylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)NCc1ccnc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C13H21N5O3/c1-9(13(19)16-5-6-21-2)17-8-10-3-4-15-11(7-10)12(14)18-20/h3-4,7,9,17,20H,5-6,8H2,1-2H3,(H2,14,18)(H,16,19) |
| InChIKey | IZAUYTMKFBZAGX-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|