C25H25F2N3O5 — CID 136869754
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(oxolan-2-ylmethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide (PubChem CID 136869754) has the molecular formula C25H25F2N3O5 and a molecular weight of 485.49 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(oxolan-2-ylmethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(oxolan-2-ylmethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 136869754 |
| Molecular Formula | C25H25F2N3O5 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(oxolan-2-ylmethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(Cc2nc3ccccc3c(=O)[nH]2)CC2CCCO2)ccc1OC(F)F |
| InChI | InChI=1S/C25H25F2N3O5/c1-33-21-13-16(8-10-20(21)35-25(26)27)9-11-23(31)30(14-17-5-4-12-34-17)15-22-28-19-7-3-2-6-18(19)24(32)29-22/h2-3,6-11,13,17,25H,4-5,12,14-15H2,1H3,(H,28,29,32)/b11-9+ |
| InChIKey | BKXVNEWUDLURRX-PKNBQFBNSA-N |
| XLogP | 3.75 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|