C11H9BrClN5S — CID 136870142
1-[(Z)-(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-(4-chlorophenyl)thiourea (PubChem CID 136870142) has the molecular formula C11H9BrClN5S and a molecular weight of 358.65 g/mol. Its IUPAC name is 1-[(Z)-(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[(Z)-(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 136870142 |
| Molecular Formula | C11H9BrClN5S |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | 1-[(Z)-(4-bromo-1H-pyrazol-5-yl)methylideneamino]-3-(4-chlorophenyl)thiourea |
| SMILES | S=C(N/N=C\c1[nH]ncc1Br)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H9BrClN5S/c12-9-5-14-17-10(9)6-15-18-11(19)16-8-3-1-7(13)2-4-8/h1-6H,(H,14,17)(H2,16,18,19)/b15-6- |
| InChIKey | VTBFTOWBOOSSRT-UUASQNMZSA-N |
| XLogP | 3.15 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|