C12H13N5S — CID 155563436
1-phenyl-3-[(E)-1-(1H-pyrazol-5-yl)ethylideneamino]thiourea (PubChem CID 155563436) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is 1-phenyl-3-[(E)-1-(1H-pyrazol-5-yl)ethylideneamino]thiourea.
| Compound Name | 1-phenyl-3-[(E)-1-(1H-pyrazol-5-yl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 155563436 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-phenyl-3-[(E)-1-(1H-pyrazol-5-yl)ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(=S)Nc1ccccc1)c1ccn[nH]1 |
| InChI | InChI=1S/C12H13N5S/c1-9(11-7-8-13-16-11)15-17-12(18)14-10-5-3-2-4-6-10/h2-8H,1H3,(H,13,16)(H2,14,17,18)/b15-9+ |
| InChIKey | NUTNYSCELJULTL-OQLLNIDSSA-N |
| XLogP | 2.12 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|