C21H17BrN4OS — CID 136873909
4-[(Z)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 136873909) has the molecular formula C21H17BrN4OS and a molecular weight of 453.37 g/mol. Its IUPAC name is 4-[(Z)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136873909 |
| Molecular Formula | C21H17BrN4OS |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 4-[(Z)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-3-(2-phenylethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Oc1ccc2cc(Br)ccc2c1/C=N\n1c(CCc2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C21H17BrN4OS/c22-16-8-9-17-15(12-16)7-10-19(27)18(17)13-23-26-20(24-25-21(26)28)11-6-14-4-2-1-3-5-14/h1-5,7-10,12-13,27H,6,11H2,(H,25,28)/b23-13- |
| InChIKey | NVXDCBMBPIDOED-QRVIBDJDSA-N |
| XLogP | 5.23 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|