C16H13Cl3N2O4 — CID 136874780
2-(2-chloro-5-methoxyphenyl)-N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 136874780) has the molecular formula C16H13Cl3N2O4 and a molecular weight of 403.65 g/mol. Its IUPAC name is 2-(2-chloro-5-methoxyphenyl)-N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-chloro-5-methoxyphenyl)-N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136874780 |
| Molecular Formula | C16H13Cl3N2O4 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 2-(2-chloro-5-methoxyphenyl)-N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(Cl)c(CC(=O)N/N=C/c2cc(Cl)c(O)c(Cl)c2O)c1 |
| InChI | InChI=1S/C16H13Cl3N2O4/c1-25-10-2-3-11(17)8(4-10)6-13(22)21-20-7-9-5-12(18)16(24)14(19)15(9)23/h2-5,7,23-24H,6H2,1H3,(H,21,22)/b20-7+ |
| InChIKey | VKRHJYZHTOILOP-IFRROFPPSA-N |
| XLogP | 3.76 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|