C19H21ClN2O3S — CID 136874809
2-(5-chloro-2-ethylsulfanylphenyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 136874809) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is 2-(5-chloro-2-ethylsulfanylphenyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-chloro-2-ethylsulfanylphenyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136874809 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-(5-chloro-2-ethylsulfanylphenyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2cc(Cl)ccc2SCC)ccc1O |
| InChI | InChI=1S/C19H21ClN2O3S/c1-3-25-17-9-13(5-7-16(17)23)12-21-22-19(24)11-14-10-15(20)6-8-18(14)26-4-2/h5-10,12,23H,3-4,11H2,1-2H3,(H,22,24)/b21-12- |
| InChIKey | JADINVGGNNAWOH-MTJSOVHGSA-N |
| XLogP | 4.25 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|