C18H18ClN3O5S — CID 136874830
2-(5-chloro-2-methylsulfanylphenyl)-N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 136874830) has the molecular formula C18H18ClN3O5S and a molecular weight of 423.88 g/mol. Its IUPAC name is 2-(5-chloro-2-methylsulfanylphenyl)-N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-chloro-2-methylsulfanylphenyl)-N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136874830 |
| Molecular Formula | C18H18ClN3O5S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 2-(5-chloro-2-methylsulfanylphenyl)-N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2cc(Cl)ccc2SC)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H18ClN3O5S/c1-3-27-15-7-11(6-14(18(15)24)22(25)26)10-20-21-17(23)9-12-8-13(19)4-5-16(12)28-2/h4-8,10,24H,3,9H2,1-2H3,(H,21,23)/b20-10- |
| InChIKey | FJPKFTHYNHMQNJ-JMIUGGIZSA-N |
| XLogP | 3.77 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|