C24H28N2O5 — CID 136877822
(1R,5R)-1-[[(Z)-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]carbamoyl]-4-methyl-5-phenylcyclohex-3-ene-1-carboxylic acid (PubChem CID 136877822) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is (1R,5R)-1-[[(Z)-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]carbamoyl]-4-methyl-5-phenylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,5R)-1-[[(Z)-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]carbamoyl]-4-methyl-5-phenylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 136877822 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (1R,5R)-1-[[(Z)-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]carbamoyl]-4-methyl-5-phenylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=CC[C@](C(=O)O)(C(=O)N/N=C\C2=C(O)CC(C)(C)CC2=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H28N2O5/c1-15-9-10-24(22(30)31,11-17(15)16-7-5-4-6-8-16)21(29)26-25-14-18-19(27)12-23(2,3)13-20(18)28/h4-9,14,17,27H,10-13H2,1-3H3,(H,26,29)(H,30,31)/b25-14-/t17-,24-/m1/s1 |
| InChIKey | BKPZODLVRRNLTP-MBVDHSAJSA-N |
| XLogP | 3.88 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|