C6H7N5O — CID 136880795
2-amino-4a,7-dihydro-3H-pteridin-4-one (PubChem CID 136880795) has the molecular formula C6H7N5O and a molecular weight of 165.16 g/mol. Its IUPAC name is 2-amino-4a,7-dihydro-3H-pteridin-4-one.
| Compound Name | 2-amino-4a,7-dihydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 136880795 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 2-amino-4a,7-dihydro-3H-pteridin-4-one |
| SMILES | NC1=NC2=NCC=NC2C(=O)N1 |
| InChI | InChI=1S/C6H7N5O/c7-6-10-4-3(5(12)11-6)8-1-2-9-4/h1,3H,2H2,(H3,7,9,10,11,12) |
| InChIKey | UXFALAUVIZWVET-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |