C26H22BrN5O2S — CID 136886935
2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide (PubChem CID 136886935) has the molecular formula C26H22BrN5O2S and a molecular weight of 548.47 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136886935 |
| Molecular Formula | C26H22BrN5O2S |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide |
| SMILES | C=CCc1cccc(/C=N\NC(=O)CSc2nnc(-c3ccccc3)n2-c2ccc(Br)cc2)c1O |
| InChI | InChI=1S/C26H22BrN5O2S/c1-2-7-18-10-6-11-20(24(18)34)16-28-29-23(33)17-35-26-31-30-25(19-8-4-3-5-9-19)32(26)22-14-12-21(27)13-15-22/h2-6,8-16,34H,1,7,17H2,(H,29,33)/b28-16- |
| InChIKey | QZADVNWMHXUJKU-NTFVMDSBSA-N |
| XLogP | 5.37 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|