C12H11N5O3 — CID 136889011
4-[5-[(4-aminopyrazol-1-yl)methyl]-1,2,4-oxadiazol-3-yl]benzene-1,2-diol (PubChem CID 136889011) has the molecular formula C12H11N5O3 and a molecular weight of 273.25 g/mol. Its IUPAC name is 4-[5-[(4-aminopyrazol-1-yl)methyl]-1,2,4-oxadiazol-3-yl]benzene-1,2-diol.
| Compound Name | 4-[5-[(4-aminopyrazol-1-yl)methyl]-1,2,4-oxadiazol-3-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136889011 |
| Molecular Formula | C12H11N5O3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-[5-[(4-aminopyrazol-1-yl)methyl]-1,2,4-oxadiazol-3-yl]benzene-1,2-diol |
| SMILES | Nc1cnn(Cc2nc(-c3ccc(O)c(O)c3)no2)c1 |
| InChI | InChI=1S/C12H11N5O3/c13-8-4-14-17(5-8)6-11-15-12(16-20-11)7-1-2-9(18)10(19)3-7/h1-5,18-19H,6,13H2 |
| InChIKey | PXEJTDBPIVRCCX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|