C12H15F3N2O2 — CID 136890421
2-(2,2,2-trifluoroethoxymethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one (PubChem CID 136890421) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxymethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one.
| Compound Name | 2-(2,2,2-trifluoroethoxymethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136890421 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxymethyl)-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(COCC(F)(F)F)nc2c1CCCCC2 |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)7-19-6-10-16-9-5-3-1-2-4-8(9)11(18)17-10/h1-7H2,(H,16,17,18) |
| InChIKey | SXABLXMUXMXOOR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |