C11H16F3N3O2 — CID 136890500
4-(propylaminomethyl)-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890500) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is 4-(propylaminomethyl)-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(propylaminomethyl)-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890500 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-(propylaminomethyl)-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidin-6-one |
| SMILES | CCCNCc1cc(=O)[nH]c(COCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N3O2/c1-2-3-15-5-8-4-10(18)17-9(16-8)6-19-7-11(12,13)14/h4,15H,2-3,5-7H2,1H3,(H,16,17,18) |
| InChIKey | ANRDGBKLTNUGRD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|