C22H28N2O4 — CID 136896024
6-hexyl-10,13,16-trioxa-2,3-diazatricyclo[15.4.0.04,9]henicosa-1(21),2,4(9),5,7,17,19-heptaen-7-ol (PubChem CID 136896024) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 6-hexyl-10,13,16-trioxa-2,3-diazatricyclo[15.4.0.04,9]henicosa-1(21),2,4(9),5,7,17,19-heptaen-7-ol.
| Compound Name | 6-hexyl-10,13,16-trioxa-2,3-diazatricyclo[15.4.0.04,9]henicosa-1(21),2,4(9),5,7,17,19-heptaen-7-ol |
|---|---|
| PubChem CID | 136896024 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 6-hexyl-10,13,16-trioxa-2,3-diazatricyclo[15.4.0.04,9]henicosa-1(21),2,4(9),5,7,17,19-heptaen-7-ol |
| SMILES | CCCCCCc1cc2c(cc1O)OCCOCCOc1ccccc1/N=N/2 |
| InChI | InChI=1S/C22H28N2O4/c1-2-3-4-5-8-17-15-19-22(16-20(17)25)28-14-12-26-11-13-27-21-10-7-6-9-18(21)23-24-19/h6-7,9-10,15-16,25H,2-5,8,11-14H2,1H3/b24-23+ |
| InChIKey | PSIMNRMILWBOQX-WCWDXBQESA-N |
| XLogP | 5.72 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|