C45H42N6O2 — CID 136897744
2-[[4-[2-[4-[[3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-ylidene]amino]phenyl]ethynyl]phenyl]iminomethyl]-5-(diethylamino)phenol (PubChem CID 136897744) has the molecular formula C45H42N6O2 and a molecular weight of 698.87 g/mol. Its IUPAC name is 2-[[4-[2-[4-[[3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-ylidene]amino]phenyl]ethynyl]phenyl]iminomethyl]-5-(diethylamino)phenol.
| Compound Name | 2-[[4-[2-[4-[[3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-ylidene]amino]phenyl]ethynyl]phenyl]iminomethyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 136897744 |
| Molecular Formula | C45H42N6O2 |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | 2-[[4-[2-[4-[[3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-ylidene]amino]phenyl]ethynyl]phenyl]iminomethyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(/C=N/c2ccc(C#Cc3ccc(/N=c4\oc5cc(N(CC)CC)ccc5cc4-c4nc5ccccc5[nH]4)cc3)cc2)c(O)c1 |
| InChI | InChI=1S/C45H42N6O2/c1-5-50(6-2)37-26-20-34(42(52)28-37)30-46-35-21-15-31(16-22-35)13-14-32-17-23-36(24-18-32)47-45-39(44-48-40-11-9-10-12-41(40)49-44)27-33-19-25-38(29-43(33)53-45)51(7-3)8-4/h9-12,15-30,52H,5-8H2,1-4H3,(H,48,49)/b46-30+,47-45- |
| InChIKey | XXEFXDIJYGXAMP-DJFSCEEOSA-N |
| XLogP | 9.76 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|