C9H16N4O3 — CID 136901112
5-amino-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136901112) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 5-amino-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136901112 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 5-amino-4-[(4-hydroxy-1-methoxybutan-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | COCC(CCO)Nc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C9H16N4O3/c1-16-4-6(2-3-14)13-8-7(10)9(15)12-5-11-8/h5-6,14H,2-4,10H2,1H3,(H2,11,12,13,15) |
| InChIKey | UKZIHSJYKUIUBD-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |