C10H16N4OS — CID 136902075
4-ethyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-1,3-thiazolidin-2-imine (PubChem CID 136902075) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-ethyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4-ethyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136902075 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-ethyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-1,3-thiazolidin-2-imine |
| SMILES | CCC1CS/C(=N\CCc2nc(C)no2)N1 |
| InChI | InChI=1S/C10H16N4OS/c1-3-8-6-16-10(13-8)11-5-4-9-12-7(2)14-15-9/h8H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | LCXQHFACOMCVLW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|