C21H19BrN6 — CID 136906269
(4S)-4-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (PubChem CID 136906269) has the molecular formula C21H19BrN6 and a molecular weight of 435.33 g/mol. Its IUPAC name is (4S)-4-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine.
| Compound Name | (4S)-4-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
|---|---|
| PubChem CID | 136906269 |
| Molecular Formula | C21H19BrN6 |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (4S)-4-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| SMILES | Cc1cc([C@H]2N=C(N)Nc3nc4ccccc4n32)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrN6/c1-12-11-16(13(2)27(12)15-9-7-14(22)8-10-15)19-25-20(23)26-21-24-17-5-3-4-6-18(17)28(19)21/h3-11,19H,1-2H3,(H3,23,24,25,26)/t19-/m0/s1 |
| InChIKey | LBNLQSCGAZIQIH-IBGZPJMESA-N |
| XLogP | 4.49 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|