C16H14N6O4 — CID 135753724
4-(2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl)-2-methoxy-5-nitrophenol (PubChem CID 135753724) has the molecular formula C16H14N6O4 and a molecular weight of 354.33 g/mol. Its IUPAC name is 4-(2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl)-2-methoxy-5-nitrophenol.
| Compound Name | 4-(2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl)-2-methoxy-5-nitrophenol |
|---|---|
| PubChem CID | 135753724 |
| Molecular Formula | C16H14N6O4 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 4-(2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl)-2-methoxy-5-nitrophenol |
| SMILES | COc1cc(C2N=C(N)Nc3nc4ccccc4n32)c([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C16H14N6O4/c1-26-13-6-8(11(22(24)25)7-12(13)23)14-19-15(17)20-16-18-9-4-2-3-5-10(9)21(14)16/h2-7,14,23H,1H3,(H3,17,18,19,20) |
| InChIKey | LLSCBDZEBXYCBN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|