C16H12N6O4 — CID 1251170
(4R)-4-(6-nitro-1,3-benzodioxol-5-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (PubChem CID 1251170) has the molecular formula C16H12N6O4 and a molecular weight of 352.31 g/mol. Its IUPAC name is (4R)-4-(6-nitro-1,3-benzodioxol-5-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine.
| Compound Name | (4R)-4-(6-nitro-1,3-benzodioxol-5-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
|---|---|
| PubChem CID | 1251170 |
| Molecular Formula | C16H12N6O4 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (4R)-4-(6-nitro-1,3-benzodioxol-5-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| SMILES | NC1=N[C@@H](c2cc3c(cc2[N+](=O)[O-])OCO3)n2c(nc3ccccc32)N1 |
| InChI | InChI=1S/C16H12N6O4/c17-15-19-14(21-10-4-2-1-3-9(10)18-16(21)20-15)8-5-12-13(26-7-25-12)6-11(8)22(23)24/h1-6,14H,7H2,(H3,17,18,19,20)/t14-/m1/s1 |
| InChIKey | VNBLHBCVIWQMNS-CQSZACIVSA-N |
| XLogP | 1.96 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|