C13H10N6O3 — CID 136806321
(4S)-4-(5-nitrofuran-2-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (PubChem CID 136806321) has the molecular formula C13H10N6O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is (4S)-4-(5-nitrofuran-2-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine.
| Compound Name | (4S)-4-(5-nitrofuran-2-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
|---|---|
| PubChem CID | 136806321 |
| Molecular Formula | C13H10N6O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (4S)-4-(5-nitrofuran-2-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| SMILES | NC1=N[C@H](c2ccc([N+](=O)[O-])o2)n2c(nc3ccccc32)N1 |
| InChI | InChI=1S/C13H10N6O3/c14-12-16-11(9-5-6-10(22-9)19(20)21)18-8-4-2-1-3-7(8)15-13(18)17-12/h1-6,11H,(H3,14,15,16,17)/t11-/m0/s1 |
| InChIKey | MJBDJYFOGFLXAU-NSHDSACASA-N |
| XLogP | 1.82 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|