C15H11BrN6O3 — CID 137241853
2-[(4R)-2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl]-4-bromo-6-nitrophenol (PubChem CID 137241853) has the molecular formula C15H11BrN6O3 and a molecular weight of 403.20 g/mol. Its IUPAC name is 2-[(4R)-2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl]-4-bromo-6-nitrophenol.
| Compound Name | 2-[(4R)-2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl]-4-bromo-6-nitrophenol |
|---|---|
| PubChem CID | 137241853 |
| Molecular Formula | C15H11BrN6O3 |
| Molecular Weight | 403.20 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2-[(4R)-2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl]-4-bromo-6-nitrophenol |
| SMILES | NC1=N[C@@H](c2cc(Br)cc([N+](=O)[O-])c2O)n2c(nc3ccccc32)N1 |
| InChI | InChI=1S/C15H11BrN6O3/c16-7-5-8(12(23)11(6-7)22(24)25)13-19-14(17)20-15-18-9-3-1-2-4-10(9)21(13)15/h1-6,13,23H,(H3,17,18,19,20)/t13-/m1/s1 |
| InChIKey | AXIRIOXTFLOTGD-CYBMUJFWSA-N |
| XLogP | 2.70 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|