C23H15Br2N3O2S — CID 136911790
(4R)-5-(1,3-benzothiazol-2-yl)-4-(3,5-dibromo-2-hydroxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 136911790) has the molecular formula C23H15Br2N3O2S and a molecular weight of 557.27 g/mol. Its IUPAC name is (4R)-5-(1,3-benzothiazol-2-yl)-4-(3,5-dibromo-2-hydroxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | (4R)-5-(1,3-benzothiazol-2-yl)-4-(3,5-dibromo-2-hydroxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 136911790 |
| Molecular Formula | C23H15Br2N3O2S |
| Molecular Weight | 557.27 g/mol |
| Exact Mass | 554.93 |
| IUPAC Name | (4R)-5-(1,3-benzothiazol-2-yl)-4-(3,5-dibromo-2-hydroxyphenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | O=C1NC(c2ccccc2)=C(c2nc3ccccc3s2)[C@@H](c2cc(Br)cc(Br)c2O)N1 |
| InChI | InChI=1S/C23H15Br2N3O2S/c24-13-10-14(21(29)15(25)11-13)20-18(22-26-16-8-4-5-9-17(16)31-22)19(27-23(30)28-20)12-6-2-1-3-7-12/h1-11,20,29H,(H2,27,28,30)/t20-/m1/s1 |
| InChIKey | AOPGVXGXMGVWEX-HXUWFJFHSA-N |
| XLogP | 6.45 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.27 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|