C10H18N4O3 — CID 136912491
(2S)-2-amino-6-[(4-methyl-5-oxoimidazolidin-2-ylidene)amino]hexanoic acid (PubChem CID 136912491) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is (2S)-2-amino-6-[(4-methyl-5-oxoimidazolidin-2-ylidene)amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(4-methyl-5-oxoimidazolidin-2-ylidene)amino]hexanoic acid |
|---|---|
| PubChem CID | 136912491 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (2S)-2-amino-6-[(4-methyl-5-oxoimidazolidin-2-ylidene)amino]hexanoic acid |
| SMILES | CC1N/C(=N\CCCC[C@H](N)C(=O)O)NC1=O |
| InChI | InChI=1S/C10H18N4O3/c1-6-8(15)14-10(13-6)12-5-3-2-4-7(11)9(16)17/h6-7H,2-5,11H2,1H3,(H,16,17)(H2,12,13,14,15)/t6?,7-/m0/s1 |
| InChIKey | OVMUYWYUNKJFMY-MLWJPKLSSA-N |
| XLogP | -0.97 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|