C14H22N2O4 — CID 139557599
(2S)-2-amino-6-[(4,4-dimethyl-2,6-dioxocyclohexylidene)amino]hexanoic acid (PubChem CID 139557599) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2S)-2-amino-6-[(4,4-dimethyl-2,6-dioxocyclohexylidene)amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(4,4-dimethyl-2,6-dioxocyclohexylidene)amino]hexanoic acid |
|---|---|
| PubChem CID | 139557599 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (2S)-2-amino-6-[(4,4-dimethyl-2,6-dioxocyclohexylidene)amino]hexanoic acid |
| SMILES | CC1(C)CC(=O)C(=NCCCC[C@H](N)C(=O)O)C(=O)C1 |
| InChI | InChI=1S/C14H22N2O4/c1-14(2)7-10(17)12(11(18)8-14)16-6-4-3-5-9(15)13(19)20/h9H,3-8,15H2,1-2H3,(H,19,20)/t9-/m0/s1 |
| InChIKey | SYSLGMNZHSETFX-VIFPVBQESA-N |
| XLogP | 0.97 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|