C21H36N2O4 — CID 146283314
ethyl (2S)-2-amino-6-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]hexanoate (PubChem CID 146283314) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is ethyl (2S)-2-amino-6-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]hexanoate.
| Compound Name | ethyl (2S)-2-amino-6-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]hexanoate |
|---|---|
| PubChem CID | 146283314 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | ethyl (2S)-2-amino-6-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]hexanoate |
| SMILES | CCOC(=O)[C@@H](N)CCCC/N=C(\CC(C)C)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C21H36N2O4/c1-6-27-20(26)15(22)9-7-8-10-23-16(11-14(2)3)19-17(24)12-21(4,5)13-18(19)25/h14-15,24H,6-13,22H2,1-5H3/b23-16+/t15-/m0/s1 |
| InChIKey | NKKOHAOZWRZSCV-IXSYQRGLSA-N |
| XLogP | 3.74 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|