C21H37NO4SSi — CID 135924614
2-trimethylsilylethyl (2S)-2-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]-3-sulfanylpropanoate (PubChem CID 135924614) has the molecular formula C21H37NO4SSi and a molecular weight of 427.68 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S)-2-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]-3-sulfanylpropanoate.
| Compound Name | 2-trimethylsilylethyl (2S)-2-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 135924614 |
| Molecular Formula | C21H37NO4SSi |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-trimethylsilylethyl (2S)-2-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbutylidene]amino]-3-sulfanylpropanoate |
| SMILES | CC(C)C/C(=N\[C@H](CS)C(=O)OCC[Si](C)(C)C)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C21H37NO4SSi/c1-14(2)10-15(19-17(23)11-21(3,4)12-18(19)24)22-16(13-27)20(25)26-8-9-28(5,6)7/h14,16,23,27H,8-13H2,1-7H3/b22-15+/t16-/m1/s1 |
| InChIKey | UEYBMNYGAMSCGA-QFNCUCFLSA-N |
| XLogP | 4.85 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|