C20H31NO4 — CID 138502657
3-hydroxy-5,5-dimethyl-2-[C-(2-methylpropyl)-N-[2-(2-prop-2-ynoxyethoxy)ethyl]carbonimidoyl]cyclohex-2-en-1-one (PubChem CID 138502657) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-[C-(2-methylpropyl)-N-[2-(2-prop-2-ynoxyethoxy)ethyl]carbonimidoyl]cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-[C-(2-methylpropyl)-N-[2-(2-prop-2-ynoxyethoxy)ethyl]carbonimidoyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 138502657 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-[C-(2-methylpropyl)-N-[2-(2-prop-2-ynoxyethoxy)ethyl]carbonimidoyl]cyclohex-2-en-1-one |
| SMILES | C#CCOCCOCC/N=C(\CC(C)C)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C20H31NO4/c1-6-8-24-10-11-25-9-7-21-16(12-15(2)3)19-17(22)13-20(4,5)14-18(19)23/h1,15,22H,7-14H2,2-5H3/b21-16+ |
| InChIKey | FPPJYONTYGRQJC-LTGZKZEYSA-N |
| XLogP | 3.34 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|