C18H14FN3O4 — CID 136916464
(2S)-2-(2-fluorophenyl)-2-[[3-(4-hydroxyphenyl)-1H-pyrazole-5-carbonyl]amino]acetic acid (PubChem CID 136916464) has the molecular formula C18H14FN3O4 and a molecular weight of 355.33 g/mol. Its IUPAC name is (2S)-2-(2-fluorophenyl)-2-[[3-(4-hydroxyphenyl)-1H-pyrazole-5-carbonyl]amino]acetic acid.
| Compound Name | (2S)-2-(2-fluorophenyl)-2-[[3-(4-hydroxyphenyl)-1H-pyrazole-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 136916464 |
| Molecular Formula | C18H14FN3O4 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (2S)-2-(2-fluorophenyl)-2-[[3-(4-hydroxyphenyl)-1H-pyrazole-5-carbonyl]amino]acetic acid |
| SMILES | O=C(N[C@H](C(=O)O)c1ccccc1F)c1cc(-c2ccc(O)cc2)n[nH]1 |
| InChI | InChI=1S/C18H14FN3O4/c19-13-4-2-1-3-12(13)16(18(25)26)20-17(24)15-9-14(21-22-15)10-5-7-11(23)8-6-10/h1-9,16,23H,(H,20,24)(H,21,22)(H,25,26)/t16-/m0/s1 |
| InChIKey | RSQOZEAEEVHVMY-INIZCTEOSA-N |
| XLogP | 2.48 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |