C24H38N6O2 — CID 136923677
1-[1-(3,4-dipropoxyphenyl)ethyl]-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enylguanidine (PubChem CID 136923677) has the molecular formula C24H38N6O2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-[1-(3,4-dipropoxyphenyl)ethyl]-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enylguanidine.
| Compound Name | 1-[1-(3,4-dipropoxyphenyl)ethyl]-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136923677 |
| Molecular Formula | C24H38N6O2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 1-[1-(3,4-dipropoxyphenyl)ethyl]-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\CCn1cnnc1CC)NC(C)c1ccc(OCCC)c(OCCC)c1 |
| InChI | InChI=1S/C24H38N6O2/c1-6-12-25-24(26-13-14-30-18-27-29-23(30)9-4)28-19(5)20-10-11-21(31-15-7-2)22(17-20)32-16-8-3/h6,10-11,17-19H,1,7-9,12-16H2,2-5H3,(H2,25,26,28) |
| InChIKey | SIZFTZDQVJBYFB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|