C9H13N3O3 — CID 136924151
4-amino-2-(5-methyl-6-oxo-1H-pyrimidin-4-yl)butanoic acid (PubChem CID 136924151) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-amino-2-(5-methyl-6-oxo-1H-pyrimidin-4-yl)butanoic acid.
| Compound Name | 4-amino-2-(5-methyl-6-oxo-1H-pyrimidin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 136924151 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4-amino-2-(5-methyl-6-oxo-1H-pyrimidin-4-yl)butanoic acid |
| SMILES | Cc1c(C(CCN)C(=O)O)nc[nH]c1=O |
| InChI | InChI=1S/C9H13N3O3/c1-5-7(11-4-12-8(5)13)6(2-3-10)9(14)15/h4,6H,2-3,10H2,1H3,(H,14,15)(H,11,12,13) |
| InChIKey | IKSRQHKNGWFKLZ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |