C13H10FIN2O3 — CID 136972220
3-(2-fluorophenyl)-2-(5-iodo-6-oxo-1H-pyrimidin-4-yl)propanoic acid (PubChem CID 136972220) has the molecular formula C13H10FIN2O3 and a molecular weight of 388.14 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-2-(5-iodo-6-oxo-1H-pyrimidin-4-yl)propanoic acid.
| Compound Name | 3-(2-fluorophenyl)-2-(5-iodo-6-oxo-1H-pyrimidin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 136972220 |
| Molecular Formula | C13H10FIN2O3 |
| Molecular Weight | 388.14 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 3-(2-fluorophenyl)-2-(5-iodo-6-oxo-1H-pyrimidin-4-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1F)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C13H10FIN2O3/c14-9-4-2-1-3-7(9)5-8(13(19)20)11-10(15)12(18)17-6-16-11/h1-4,6,8H,5H2,(H,19,20)(H,16,17,18) |
| InChIKey | VHOXHBUNUGAXLS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|