C11H12N2O8 — CID 174290538
2-[4-(1,2-dicarboxyethyl)-1H-imidazol-5-yl]butanedioic acid (PubChem CID 174290538) has the molecular formula C11H12N2O8 and a molecular weight of 300.22 g/mol. Its IUPAC name is 2-[4-(1,2-dicarboxyethyl)-1H-imidazol-5-yl]butanedioic acid.
| Compound Name | 2-[4-(1,2-dicarboxyethyl)-1H-imidazol-5-yl]butanedioic acid |
|---|---|
| PubChem CID | 174290538 |
| Molecular Formula | C11H12N2O8 |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[4-(1,2-dicarboxyethyl)-1H-imidazol-5-yl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)c1nc[nH]c1C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H12N2O8/c14-6(15)1-4(10(18)19)8-9(13-3-12-8)5(11(20)21)2-7(16)17/h3-5H,1-2H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | ZTXVTZDXJZFPCM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 177.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |