C18H14ClN3O11 — CID 174327513
2-[4-(4-chloro-2-nitrobenzoyl)-3-(1,2-dicarboxyethyl)-1H-pyrazol-5-yl]butanedioic acid (PubChem CID 174327513) has the molecular formula C18H14ClN3O11 and a molecular weight of 483.77 g/mol. Its IUPAC name is 2-[4-(4-chloro-2-nitrobenzoyl)-3-(1,2-dicarboxyethyl)-1H-pyrazol-5-yl]butanedioic acid.
| Compound Name | 2-[4-(4-chloro-2-nitrobenzoyl)-3-(1,2-dicarboxyethyl)-1H-pyrazol-5-yl]butanedioic acid |
|---|---|
| PubChem CID | 174327513 |
| Molecular Formula | C18H14ClN3O11 |
| Molecular Weight | 483.77 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 2-[4-(4-chloro-2-nitrobenzoyl)-3-(1,2-dicarboxyethyl)-1H-pyrazol-5-yl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)c1n[nH]c(C(CC(=O)O)C(=O)O)c1C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14ClN3O11/c19-6-1-2-7(10(3-6)22(32)33)16(27)13-14(8(17(28)29)4-11(23)24)20-21-15(13)9(18(30)31)5-12(25)26/h1-3,8-9H,4-5H2,(H,20,21)(H,23,24)(H,25,26)(H,28,29)(H,30,31) |
| InChIKey | GMGWMPXIUBIYBO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 238.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.77 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|