C13H13FN2O4 — CID 136930965
3-[3-[(dimethylamino)methyl]-5-fluoro-2-hydroxyphenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 136930965) has the molecular formula C13H13FN2O4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 3-[3-[(dimethylamino)methyl]-5-fluoro-2-hydroxyphenyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[3-[(dimethylamino)methyl]-5-fluoro-2-hydroxyphenyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136930965 |
| Molecular Formula | C13H13FN2O4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-[3-[(dimethylamino)methyl]-5-fluoro-2-hydroxyphenyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | CN(C)Cc1cc(F)cc(-c2cc(C(=O)O)on2)c1O |
| InChI | InChI=1S/C13H13FN2O4/c1-16(2)6-7-3-8(14)4-9(12(7)17)10-5-11(13(18)19)20-15-10/h3-5,17H,6H2,1-2H3,(H,18,19) |
| InChIKey | IOQCSKPNPSTFLU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|