C15H14ClN3O2S — CID 136932863
3-[5-(4-chlorophenyl)-2-methyl-1,2,4-triazol-3-yl]-4-hydroxy-5,5-dimethylthiophen-2-one (PubChem CID 136932863) has the molecular formula C15H14ClN3O2S and a molecular weight of 335.82 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-2-methyl-1,2,4-triazol-3-yl]-4-hydroxy-5,5-dimethylthiophen-2-one.
| Compound Name | 3-[5-(4-chlorophenyl)-2-methyl-1,2,4-triazol-3-yl]-4-hydroxy-5,5-dimethylthiophen-2-one |
|---|---|
| PubChem CID | 136932863 |
| Molecular Formula | C15H14ClN3O2S |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-2-methyl-1,2,4-triazol-3-yl]-4-hydroxy-5,5-dimethylthiophen-2-one |
| SMILES | Cn1nc(-c2ccc(Cl)cc2)nc1C1=C(O)C(C)(C)SC1=O |
| InChI | InChI=1S/C15H14ClN3O2S/c1-15(2)11(20)10(14(21)22-15)13-17-12(18-19(13)3)8-4-6-9(16)7-5-8/h4-7,20H,1-3H3 |
| InChIKey | SQDIJNXGMRDARX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|