C25H19N4O4S+ — CID 136940060
6-(1,3-benzodioxol-5-yl)-7-benzoyl-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136940060) has the molecular formula C25H19N4O4S+ and a molecular weight of 471.52 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-7-benzoyl-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-7-benzoyl-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136940060 |
| Molecular Formula | C25H19N4O4S+ |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-7-benzoyl-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(=O)c1ccccc1)C2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H18N4O4S/c1-34-25-26-22(30)21-17-9-5-6-10-18(17)28(24(31)15-7-3-2-4-8-15)23(29(21)27-25)16-11-12-19-20(13-16)33-14-32-19/h2-13,23H,14H2,1H3/p+1 |
| InChIKey | JSCDMZRGVHLHHY-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|